C18H23NO7S — CID 132575909
methyl (3aS,4R,5R,7aR)-5-hydroxy-2,2-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate (PubChem CID 132575909) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is methyl (3aS,4R,5R,7aR)-5-hydroxy-2,2-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate.
| Compound Name | methyl (3aS,4R,5R,7aR)-5-hydroxy-2,2-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate |
|---|---|
| PubChem CID | 132575909 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | methyl (3aS,4R,5R,7aR)-5-hydroxy-2,2-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12OC(C)(C)O[C@@H]1C=C[C@@H](O)[C@H]2NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO7S/c1-11-5-7-12(8-6-11)27(22,23)19-15-13(20)9-10-14-18(15,16(21)24-4)26-17(2,3)25-14/h5-10,13-15,19-20H,1-4H3/t13-,14-,15-,18-/m1/s1 |
| InChIKey | AKCAETNJZGLDQP-ATNYBXOESA-N |
| XLogP | 0.64 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|