C22H35NO5SSi — CID 11775377
N-[(3aS,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-4-methylbenzenesulfonamide (PubChem CID 11775377) has the molecular formula C22H35NO5SSi and a molecular weight of 453.68 g/mol. Its IUPAC name is N-[(3aS,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3aS,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11775377 |
| Molecular Formula | C22H35NO5SSi |
| Molecular Weight | 453.68 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-[(3aS,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C22H35NO5SSi/c1-15-9-11-16(12-10-15)29(24,25)23-17-13-14-18(28-30(7,8)21(2,3)4)20-19(17)26-22(5,6)27-20/h9-14,17-20,23H,1-8H3/t17-,18+,19+,20-/m1/s1 |
| InChIKey | DKTOADYHPPVHLY-FUMNGEBKSA-N |
| XLogP | 4.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|