C13H14N2O4S — CID 10565716
N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]-4-methylbenzenesulfonamide (PubChem CID 10565716) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10565716 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2C=C[C@H]3OC(=O)N[C@@H]23)cc1 |
| InChI | InChI=1S/C13H14N2O4S/c1-8-2-4-9(5-3-8)20(17,18)15-10-6-7-11-12(10)14-13(16)19-11/h2-7,10-12,15H,1H3,(H,14,16)/t10-,11-,12+/m1/s1 |
| InChIKey | OFHDUUYUEJCKDD-UTUOFQBUSA-N |
| XLogP | 0.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|