C12H15NO2S — CID 11183983
N-cyclopent-2-en-1-yl-4-methylbenzenesulfonamide (PubChem CID 11183983) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is N-cyclopent-2-en-1-yl-4-methylbenzenesulfonamide.
| Compound Name | N-cyclopent-2-en-1-yl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11183983 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-cyclopent-2-en-1-yl-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2C=CCC2)cc1 |
| InChI | InChI=1S/C12H15NO2S/c1-10-6-8-12(9-7-10)16(14,15)13-11-4-2-3-5-11/h2,4,6-9,11,13H,3,5H2,1H3 |
| InChIKey | KFHANGVDOOPYBY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|