C12H14N2O3S — CID 101215814
N-cyclohex-2-en-1-yl-4-nitrosobenzenesulfonamide (PubChem CID 101215814) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-4-nitrosobenzenesulfonamide.
| Compound Name | N-cyclohex-2-en-1-yl-4-nitrosobenzenesulfonamide |
|---|---|
| PubChem CID | 101215814 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-cyclohex-2-en-1-yl-4-nitrosobenzenesulfonamide |
| SMILES | O=Nc1ccc(S(=O)(=O)NC2C=CCCC2)cc1 |
| InChI | InChI=1S/C12H14N2O3S/c15-13-10-6-8-12(9-7-10)18(16,17)14-11-4-2-1-3-5-11/h2,4,6-9,11,14H,1,3,5H2 |
| InChIKey | IFQSCXDWZUCDFQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|