C14H18N2O3S — CID 135041692
N'-cyclopent-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide (PubChem CID 135041692) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N'-cyclopent-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide.
| Compound Name | N'-cyclopent-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 135041692 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N'-cyclopent-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide |
| SMILES | CC(=O)N(NC1C=CCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c1-11-7-9-14(10-8-11)20(18,19)16(12(2)17)15-13-5-3-4-6-13/h3,5,7-10,13,15H,4,6H2,1-2H3 |
| InChIKey | NDWGYGWULRTGNJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|