C22H35NO6SSi — CID 15666491
methyl (1R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-[(4-methylphenyl)sulfonylamino]cyclohex-2-ene-1-carboxylate (PubChem CID 15666491) has the molecular formula C22H35NO6SSi and a molecular weight of 469.68 g/mol. Its IUPAC name is methyl (1R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-[(4-methylphenyl)sulfonylamino]cyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-[(4-methylphenyl)sulfonylamino]cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 15666491 |
| Molecular Formula | C22H35NO6SSi |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | methyl (1R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-[(4-methylphenyl)sulfonylamino]cyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C=C[C@@H](NS(=O)(=O)c2ccc(C)cc2)C[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35NO6SSi/c1-16-8-10-19(11-9-16)30(26,27)23-18-12-13-22(25,20(24)28-5)17(14-18)15-29-31(6,7)21(2,3)4/h8-13,17-18,23,25H,14-15H2,1-7H3/t17-,18-,22-/m1/s1 |
| InChIKey | AVBFOYMZNLQNDA-JBYIUTFZSA-N |
| XLogP | 3.14 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|