C20H25NO10S — CID 100960659
[(1R,2S,3S,4S,5R,7S)-3,4-diacetyloxy-5-methyl-7-[(4-methylphenyl)sulfonylamino]-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 100960659) has the molecular formula C20H25NO10S and a molecular weight of 471.48 g/mol. Its IUPAC name is [(1R,2S,3S,4S,5R,7S)-3,4-diacetyloxy-5-methyl-7-[(4-methylphenyl)sulfonylamino]-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(1R,2S,3S,4S,5R,7S)-3,4-diacetyloxy-5-methyl-7-[(4-methylphenyl)sulfonylamino]-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 100960659 |
| Molecular Formula | C20H25NO10S |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | [(1R,2S,3S,4S,5R,7S)-3,4-diacetyloxy-5-methyl-7-[(4-methylphenyl)sulfonylamino]-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2O[C@](C)(O[C@@H]2NS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO10S/c1-10-6-8-14(9-7-10)32(25,26)21-19-17-15(27-11(2)22)16(28-12(3)23)18(29-13(4)24)20(5,30-17)31-19/h6-9,15-19,21H,1-5H3/t15-,16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | PNHCSLWZHOVBKG-CFSBILQPSA-N |
| XLogP | 0.54 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|