C19H23N3O11S — CID 175549158
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-azido-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 175549158) has the molecular formula C19H23N3O11S and a molecular weight of 501.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-azido-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-azido-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 175549158 |
| Molecular Formula | C19H23N3O11S |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-azido-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O[C@](O)(N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H23N3O11S/c1-10-5-7-14(8-6-10)34(27,28)29-9-15-16(30-11(2)23)17(31-12(3)24)18(32-13(4)25)19(26,33-15)21-22-20/h5-8,15-18,26H,9H2,1-4H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | OLWIZBAXDUOXMK-FQBWVUSXSA-N |
| XLogP | 0.85 |
| TPSA | 200.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|