C18H22N2O7S — CID 172923930
[(1R,4S,5Z,7S)-7-acetyloxy-5-[(4-methylphenyl)sulfonylhydrazinylidene]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate (PubChem CID 172923930) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is [(1R,4S,5Z,7S)-7-acetyloxy-5-[(4-methylphenyl)sulfonylhydrazinylidene]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate.
| Compound Name | [(1R,4S,5Z,7S)-7-acetyloxy-5-[(4-methylphenyl)sulfonylhydrazinylidene]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 172923930 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(1R,4S,5Z,7S)-7-acetyloxy-5-[(4-methylphenyl)sulfonylhydrazinylidene]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C/C(=N/NS(=O)(=O)c3ccc(C)cc3)[C@@H](CO1)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C18H22N2O7S/c1-11-4-6-14(7-5-11)28(23,24)20-19-16-8-18(10-25-12(2)21)17(27-13(3)22)15(16)9-26-18/h4-7,15,17,20H,8-10H2,1-3H3/b19-16-/t15-,17+,18-/m1/s1 |
| InChIKey | FQAJESYUDYFZMG-RQEGMVJYSA-N |
| XLogP | 0.91 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|