C21H16F7NO5S — CID 102299763
methyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate (PubChem CID 102299763) has the molecular formula C21H16F7NO5S and a molecular weight of 527.41 g/mol. Its IUPAC name is methyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate.
| Compound Name | methyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 102299763 |
| Molecular Formula | C21H16F7NO5S |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | methyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)C(F)(F)C(F)(F)F)Oc2ccccc2C1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H16F7NO5S/c1-11-7-9-12(10-8-11)35(31,32)29-16-13-5-3-4-6-14(13)34-17(15(16)18(30)33-2)19(22,23)20(24,25)21(26,27)28/h3-10,16,29H,1-2H3 |
| InChIKey | KNTMQWAUVNMNIT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|