C18H19NO5S — CID 134836426
(NZ)-N-[4-hydroxy-3-(methoxymethyl)-3,4-dihydrochromen-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 134836426) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is (NZ)-N-[4-hydroxy-3-(methoxymethyl)-3,4-dihydrochromen-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[4-hydroxy-3-(methoxymethyl)-3,4-dihydrochromen-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134836426 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (NZ)-N-[4-hydroxy-3-(methoxymethyl)-3,4-dihydrochromen-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | COCC1/C(=N/S(=O)(=O)c2ccc(C)cc2)Oc2ccccc2C1O |
| InChI | InChI=1S/C18H19NO5S/c1-12-7-9-13(10-8-12)25(21,22)19-18-15(11-23-2)17(20)14-5-3-4-6-16(14)24-18/h3-10,15,17,20H,11H2,1-2H3/b19-18- |
| InChIKey | UEAGMMREXMKVLJ-HNENSFHCSA-N |
| XLogP | 2.47 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|