C21H19NO4S — CID 102105075
N-(3-methoxy-9H-xanthen-9-yl)-4-methylbenzenesulfonamide (PubChem CID 102105075) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is N-(3-methoxy-9H-xanthen-9-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3-methoxy-9H-xanthen-9-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102105075 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-(3-methoxy-9H-xanthen-9-yl)-4-methylbenzenesulfonamide |
| SMILES | COc1ccc2c(c1)Oc1ccccc1C2NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H19NO4S/c1-14-7-10-16(11-8-14)27(23,24)22-21-17-5-3-4-6-19(17)26-20-13-15(25-2)9-12-18(20)21/h3-13,21-22H,1-2H3 |
| InChIKey | DNRGEAHKNKERBW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |