C23H19NO4S — CID 102040404
N-[(4S)-3-formyl-2-phenyl-4H-chromen-4-yl]-4-methylbenzenesulfonamide (PubChem CID 102040404) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[(4S)-3-formyl-2-phenyl-4H-chromen-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(4S)-3-formyl-2-phenyl-4H-chromen-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102040404 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(4S)-3-formyl-2-phenyl-4H-chromen-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2C(C=O)=C(c3ccccc3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C23H19NO4S/c1-16-11-13-18(14-12-16)29(26,27)24-22-19-9-5-6-10-21(19)28-23(20(22)15-25)17-7-3-2-4-8-17/h2-15,22,24H,1H3/t22-/m0/s1 |
| InChIKey | ILZSMMXDTQMVCV-QFIPXVFZSA-N |
| XLogP | 4.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|