C21H17NO5S — CID 4786910
N-(9H-xanthen-9-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 4786910) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is N-(9H-xanthen-9-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(9H-xanthen-9-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 4786910 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(9H-xanthen-9-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=S(=O)(NC1c2ccccc2Oc2ccccc21)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H17NO5S/c23-28(24,14-9-10-19-20(13-14)26-12-11-25-19)22-21-15-5-1-3-7-17(15)27-18-8-4-2-6-16(18)21/h1-10,13,21-22H,11-12H2 |
| InChIKey | ZXADWTQHQDTOSM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |