C19H16F3NO5S — CID 102299766
methyl 4-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)-4H-chromene-3-carboxylate (PubChem CID 102299766) has the molecular formula C19H16F3NO5S and a molecular weight of 427.40 g/mol. Its IUPAC name is methyl 4-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)-4H-chromene-3-carboxylate.
| Compound Name | methyl 4-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 102299766 |
| Molecular Formula | C19H16F3NO5S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | methyl 4-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)-4H-chromene-3-carboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)Oc2ccccc2C1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H16F3NO5S/c1-11-7-9-12(10-8-11)29(25,26)23-16-13-5-3-4-6-14(13)28-17(19(20,21)22)15(16)18(24)27-2/h3-10,16,23H,1-2H3 |
| InChIKey | DBOZMEFCTGPMBY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |