C13H11F3O5 — CID 102299769
methyl 4-hydroxy-8-methoxy-2-(trifluoromethyl)-4H-chromene-3-carboxylate (PubChem CID 102299769) has the molecular formula C13H11F3O5 and a molecular weight of 304.22 g/mol. Its IUPAC name is methyl 4-hydroxy-8-methoxy-2-(trifluoromethyl)-4H-chromene-3-carboxylate.
| Compound Name | methyl 4-hydroxy-8-methoxy-2-(trifluoromethyl)-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 102299769 |
| Molecular Formula | C13H11F3O5 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 4-hydroxy-8-methoxy-2-(trifluoromethyl)-4H-chromene-3-carboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)Oc2c(OC)cccc2C1O |
| InChI | InChI=1S/C13H11F3O5/c1-19-7-5-3-4-6-9(17)8(12(18)20-2)11(13(14,15)16)21-10(6)7/h3-5,9,17H,1-2H3 |
| InChIKey | QTLYKNNHETWCKS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |