C19H19NO6S — CID 102595137
methyl 6-methoxy-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate (PubChem CID 102595137) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl 6-methoxy-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate.
| Compound Name | methyl 6-methoxy-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 102595137 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | methyl 6-methoxy-4-[(4-methylphenyl)sulfonylamino]-4H-chromene-3-carboxylate |
| SMILES | COC(=O)C1=COc2ccc(OC)cc2C1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19NO6S/c1-12-4-7-14(8-5-12)27(22,23)20-18-15-10-13(24-2)6-9-17(15)26-11-16(18)19(21)25-3/h4-11,18,20H,1-3H3 |
| InChIKey | WLZOJFWVSBRSNJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |