C14H20O8S — CID 54218560
(2S,3S,4S,5R,6S)-2-[hydroxy-(4-methylphenyl)sulfonylmethyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 54218560) has the molecular formula C14H20O8S and a molecular weight of 348.37 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-[hydroxy-(4-methylphenyl)sulfonylmethyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6S)-2-[hydroxy-(4-methylphenyl)sulfonylmethyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 54218560 |
| Molecular Formula | C14H20O8S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-[hydroxy-(4-methylphenyl)sulfonylmethyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@H]1O[C@H](C(O)S(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20O8S/c1-7-3-5-8(6-4-7)23(19,20)13(18)12-10(16)9(15)11(17)14(21-2)22-12/h3-6,9-18H,1-2H3/t9-,10-,11+,12-,13?,14-/m0/s1 |
| InChIKey | QAXBSJMIBAAAPB-JXXSAXMXSA-N |
| XLogP | -1.46 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |