C22H34O9S — CID 68591684
(3aS,5R,6S,6aS)-3a-(2-butoxyethoxymethyl)-5-[hydroxy-(4-methylphenyl)sulfonylmethyl]-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 68591684) has the molecular formula C22H34O9S and a molecular weight of 474.57 g/mol. Its IUPAC name is (3aS,5R,6S,6aS)-3a-(2-butoxyethoxymethyl)-5-[hydroxy-(4-methylphenyl)sulfonylmethyl]-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5R,6S,6aS)-3a-(2-butoxyethoxymethyl)-5-[hydroxy-(4-methylphenyl)sulfonylmethyl]-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 68591684 |
| Molecular Formula | C22H34O9S |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (3aS,5R,6S,6aS)-3a-(2-butoxyethoxymethyl)-5-[hydroxy-(4-methylphenyl)sulfonylmethyl]-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CCCCOCCOC[C@@]12O[C@@H](C(O)S(=O)(=O)c3ccc(C)cc3)[C@@H](O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C22H34O9S/c1-5-6-11-27-12-13-28-14-22-19(30-21(3,4)31-22)17(23)18(29-22)20(24)32(25,26)16-9-7-15(2)8-10-16/h7-10,17-20,23-24H,5-6,11-14H2,1-4H3/t17-,18-,19+,20?,22+/m1/s1 |
| InChIKey | OCSJMFYSMPIRQK-BEIJKFFHSA-N |
| XLogP | 1.53 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|