C24H29IO6S — CID 10816916
ethyl 3-(benzenesulfonylmethyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]-6-iodohexanoate (PubChem CID 10816916) has the molecular formula C24H29IO6S and a molecular weight of 572.46 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonylmethyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]-6-iodohexanoate.
| Compound Name | ethyl 3-(benzenesulfonylmethyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]-6-iodohexanoate |
|---|---|
| PubChem CID | 10816916 |
| Molecular Formula | C24H29IO6S |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | ethyl 3-(benzenesulfonylmethyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]-6-iodohexanoate |
| SMILES | CCOC(=O)C(c1ccccc1C1OCCO1)C(CCCI)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H29IO6S/c1-2-29-23(26)22(20-12-6-7-13-21(20)24-30-15-16-31-24)18(9-8-14-25)17-32(27,28)19-10-4-3-5-11-19/h3-7,10-13,18,22,24H,2,8-9,14-17H2,1H3 |
| InChIKey | OIGPOCPOJNDIKC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|