C24H28O6S — CID 15373664
[2-[4-(benzenesulfonylmethyl)-1,3-dioxolan-2-yl]cyclohexyl]methyl benzoate (PubChem CID 15373664) has the molecular formula C24H28O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is [2-[4-(benzenesulfonylmethyl)-1,3-dioxolan-2-yl]cyclohexyl]methyl benzoate.
| Compound Name | [2-[4-(benzenesulfonylmethyl)-1,3-dioxolan-2-yl]cyclohexyl]methyl benzoate |
|---|---|
| PubChem CID | 15373664 |
| Molecular Formula | C24H28O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [2-[4-(benzenesulfonylmethyl)-1,3-dioxolan-2-yl]cyclohexyl]methyl benzoate |
| SMILES | O=C(OCC1CCCCC1C1OCC(CS(=O)(=O)c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C24H28O6S/c25-23(18-9-3-1-4-10-18)28-15-19-11-7-8-14-22(19)24-29-16-20(30-24)17-31(26,27)21-12-5-2-6-13-21/h1-6,9-10,12-13,19-20,22,24H,7-8,11,14-17H2 |
| InChIKey | IUBDTMHOSCOCOZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |