C24H25F3O4S — CID 163359701
[(E)-1-cyclohexyl-5-(3,4,5-trifluorophenyl)sulfonylpent-3-enyl] benzoate (PubChem CID 163359701) has the molecular formula C24H25F3O4S and a molecular weight of 466.52 g/mol. Its IUPAC name is [(E)-1-cyclohexyl-5-(3,4,5-trifluorophenyl)sulfonylpent-3-enyl] benzoate.
| Compound Name | [(E)-1-cyclohexyl-5-(3,4,5-trifluorophenyl)sulfonylpent-3-enyl] benzoate |
|---|---|
| PubChem CID | 163359701 |
| Molecular Formula | C24H25F3O4S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(E)-1-cyclohexyl-5-(3,4,5-trifluorophenyl)sulfonylpent-3-enyl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1cc(F)c(F)c(F)c1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H25F3O4S/c25-20-15-19(16-21(26)23(20)27)32(29,30)14-8-7-13-22(17-9-3-1-4-10-17)31-24(28)18-11-5-2-6-12-18/h2,5-8,11-12,15-17,22H,1,3-4,9-10,13-14H2/b8-7+ |
| InChIKey | ROYFAOCTDRMMDB-BQYQJAHWSA-N |
| XLogP | 5.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|