C27H25F3O4S — CID 163359665
[(E)-7-(benzenesulfonyl)-1-[2-(trifluoromethyl)phenyl]hept-5-en-3-yl] benzoate (PubChem CID 163359665) has the molecular formula C27H25F3O4S and a molecular weight of 502.55 g/mol. Its IUPAC name is [(E)-7-(benzenesulfonyl)-1-[2-(trifluoromethyl)phenyl]hept-5-en-3-yl] benzoate.
| Compound Name | [(E)-7-(benzenesulfonyl)-1-[2-(trifluoromethyl)phenyl]hept-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 163359665 |
| Molecular Formula | C27H25F3O4S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | [(E)-7-(benzenesulfonyl)-1-[2-(trifluoromethyl)phenyl]hept-5-en-3-yl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1ccccc1)CCc1ccccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C27H25F3O4S/c28-27(29,30)25-17-8-7-11-21(25)18-19-23(34-26(31)22-12-3-1-4-13-22)14-9-10-20-35(32,33)24-15-5-2-6-16-24/h1-13,15-17,23H,14,18-20H2/b10-9+ |
| InChIKey | KSTUHFZJWTXHOD-MDZDMXLPSA-N |
| XLogP | 6.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|