C22H24O6S — CID 10597996
(E)-7-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]hept-6-enoic acid (PubChem CID 10597996) has the molecular formula C22H24O6S and a molecular weight of 416.50 g/mol. Its IUPAC name is (E)-7-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]hept-6-enoic acid.
| Compound Name | (E)-7-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]hept-6-enoic acid |
|---|---|
| PubChem CID | 10597996 |
| Molecular Formula | C22H24O6S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (E)-7-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]hept-6-enoic acid |
| SMILES | O=C(O)C(CCC/C=C/S(=O)(=O)c1ccccc1)c1ccccc1C1OCCO1 |
| InChI | InChI=1S/C22H24O6S/c23-21(24)19(18-11-6-7-13-20(18)22-27-14-15-28-22)12-5-2-8-16-29(25,26)17-9-3-1-4-10-17/h1,3-4,6-11,13,16,19,22H,2,5,12,14-15H2,(H,23,24)/b16-8+ |
| InChIKey | QBIDRYJRXMXIMW-LZYBPNLTSA-N |
| XLogP | 4.06 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|