C23H26O6S — CID 10693940
(E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoic acid (PubChem CID 10693940) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is (E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoic acid.
| Compound Name | (E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoic acid |
|---|---|
| PubChem CID | 10693940 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoic acid |
| SMILES | O=C(O)C(CCCC/C=C/S(=O)(=O)c1ccccc1)c1ccccc1C1OCCO1 |
| InChI | InChI=1S/C23H26O6S/c24-22(25)20(19-12-7-8-14-21(19)23-28-15-16-29-23)13-6-1-2-9-17-30(26,27)18-10-4-3-5-11-18/h3-5,7-12,14,17,20,23H,1-2,6,13,15-16H2,(H,24,25)/b17-9+ |
| InChIKey | UNGWJFLNTQJGAD-RQZCQDPDSA-N |
| XLogP | 4.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|