C25H30O6S — CID 10718710
ethyl (E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoate (PubChem CID 10718710) has the molecular formula C25H30O6S and a molecular weight of 458.58 g/mol. Its IUPAC name is ethyl (E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoate.
| Compound Name | ethyl (E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoate |
|---|---|
| PubChem CID | 10718710 |
| Molecular Formula | C25H30O6S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | ethyl (E)-8-(benzenesulfonyl)-2-[2-(1,3-dioxolan-2-yl)phenyl]oct-7-enoate |
| SMILES | CCOC(=O)C(CCCC/C=C/S(=O)(=O)c1ccccc1)c1ccccc1C1OCCO1 |
| InChI | InChI=1S/C25H30O6S/c1-2-29-24(26)22(21-14-9-10-16-23(21)25-30-17-18-31-25)15-8-3-4-11-19-32(27,28)20-12-6-5-7-13-20/h5-7,9-14,16,19,22,25H,2-4,8,15,17-18H2,1H3/b19-11+ |
| InChIKey | PDLRVMGXOUMWDP-YBFXNURJSA-N |
| XLogP | 4.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|