C20H20O5S — CID 11025113
(2R,4R,5R)-4-(benzenesulfonyl)-2-phenyl-1,10-dioxaspiro[4.5]decan-6-one (PubChem CID 11025113) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is (2R,4R,5R)-4-(benzenesulfonyl)-2-phenyl-1,10-dioxaspiro[4.5]decan-6-one.
| Compound Name | (2R,4R,5R)-4-(benzenesulfonyl)-2-phenyl-1,10-dioxaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 11025113 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (2R,4R,5R)-4-(benzenesulfonyl)-2-phenyl-1,10-dioxaspiro[4.5]decan-6-one |
| SMILES | O=C1CCCO[C@@]12O[C@@H](c1ccccc1)C[C@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O5S/c21-18-12-7-13-24-20(18)19(26(22,23)16-10-5-2-6-11-16)14-17(25-20)15-8-3-1-4-9-15/h1-6,8-11,17,19H,7,12-14H2/t17-,19-,20-/m1/s1 |
| InChIKey | SQZIIWKFWRFUOH-MISYRCLQSA-N |
| XLogP | 3.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |