C33H44O7S — CID 10507544
2-(benzenesulfinyl)-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one (PubChem CID 10507544) has the molecular formula C33H44O7S and a molecular weight of 584.78 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one.
| Compound Name | 2-(benzenesulfinyl)-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 10507544 |
| Molecular Formula | C33H44O7S |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 2-(benzenesulfinyl)-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one |
| SMILES | C=CC[C@@H]1C[C@H](C(=O)C(C[C@@H]2C[C@H](CCOCc3ccccc3)OC(C)(C)O2)S(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C33H44O7S/c1-6-13-25-21-29(40-33(4,5)37-25)31(34)30(41(35)28-16-11-8-12-17-28)22-27-20-26(38-32(2,3)39-27)18-19-36-23-24-14-9-7-10-15-24/h6-12,14-17,25-27,29-30H,1,13,18-23H2,2-5H3/t25-,26+,27+,29-,30?,41?/m1/s1 |
| InChIKey | YRWOMSOXOBDBLS-SCGIFZTBSA-N |
| XLogP | 6.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|