C32H38O7S — CID 134918116
S-ethyl (2R,3S,4S,5R,6S)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate (PubChem CID 134918116) has the molecular formula C32H38O7S and a molecular weight of 566.72 g/mol. Its IUPAC name is S-ethyl (2R,3S,4S,5R,6S)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate.
| Compound Name | S-ethyl (2R,3S,4S,5R,6S)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate |
|---|---|
| PubChem CID | 134918116 |
| Molecular Formula | C32H38O7S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | S-ethyl (2R,3S,4S,5R,6S)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate |
| SMILES | CCSC(=O)[C@@H]1O[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCOC |
| InChI | InChI=1S/C32H38O7S/c1-3-40-32(33)31-30(38-23-34-2)29(37-21-26-17-11-6-12-18-26)28(36-20-25-15-9-5-10-16-25)27(39-31)22-35-19-24-13-7-4-8-14-24/h4-18,27-31H,3,19-23H2,1-2H3/t27-,28+,29-,30-,31+/m0/s1 |
| InChIKey | QZGOEXBJBSVUMA-GKFQJYPJSA-N |
| XLogP | 5.41 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|