C18H18O4S — CID 10853895
(2S,6R)-2-(benzenesulfonylmethyl)-6-phenyloxan-3-one (PubChem CID 10853895) has the molecular formula C18H18O4S and a molecular weight of 330.40 g/mol. Its IUPAC name is (2S,6R)-2-(benzenesulfonylmethyl)-6-phenyloxan-3-one.
| Compound Name | (2S,6R)-2-(benzenesulfonylmethyl)-6-phenyloxan-3-one |
|---|---|
| PubChem CID | 10853895 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (2S,6R)-2-(benzenesulfonylmethyl)-6-phenyloxan-3-one |
| SMILES | O=C1CC[C@H](c2ccccc2)O[C@@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O4S/c19-16-11-12-17(14-7-3-1-4-8-14)22-18(16)13-23(20,21)15-9-5-2-6-10-15/h1-10,17-18H,11-13H2/t17-,18-/m1/s1 |
| InChIKey | UANHJMNYVMDWEC-QZTJIDSGSA-N |
| XLogP | 2.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |