C32H42O7S4 — CID 10952477
S-[3-[3-[(2R)-2-(oxan-2-yloxy)-2-phenylacetyl]sulfanylpropylsulfinylsulfanyl]propyl] (2R)-2-(oxan-2-yloxy)-2-phenylethanethioate (PubChem CID 10952477) has the molecular formula C32H42O7S4 and a molecular weight of 666.95 g/mol. Its IUPAC name is S-[3-[3-[(2R)-2-(oxan-2-yloxy)-2-phenylacetyl]sulfanylpropylsulfinylsulfanyl]propyl] (2R)-2-(oxan-2-yloxy)-2-phenylethanethioate.
| Compound Name | S-[3-[3-[(2R)-2-(oxan-2-yloxy)-2-phenylacetyl]sulfanylpropylsulfinylsulfanyl]propyl] (2R)-2-(oxan-2-yloxy)-2-phenylethanethioate |
|---|---|
| PubChem CID | 10952477 |
| Molecular Formula | C32H42O7S4 |
| Molecular Weight | 666.95 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | S-[3-[3-[(2R)-2-(oxan-2-yloxy)-2-phenylacetyl]sulfanylpropylsulfinylsulfanyl]propyl] (2R)-2-(oxan-2-yloxy)-2-phenylethanethioate |
| SMILES | O=C(SCCCSS(=O)CCCSC(=O)[C@H](OC1CCCCO1)c1ccccc1)[C@H](OC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C32H42O7S4/c33-31(29(25-13-3-1-4-14-25)38-27-17-7-9-19-36-27)40-21-11-23-42-43(35)24-12-22-41-32(34)30(26-15-5-2-6-16-26)39-28-18-8-10-20-37-28/h1-6,13-16,27-30H,7-12,17-24H2/t27?,28?,29-,30-,43?/m1/s1 |
| InChIKey | VSIRAPXVQHXVDQ-QRSCYWODSA-N |
| XLogP | 7.25 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.95 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|