C35H52O4S — CID 59037073
2-[2-methyl-6-[5-(oxan-2-yloxy)-5-phenylhexyl]sulfinyl-2-phenylhexyl]oxane (PubChem CID 59037073) has the molecular formula C35H52O4S and a molecular weight of 568.86 g/mol. Its IUPAC name is 2-[2-methyl-6-[5-(oxan-2-yloxy)-5-phenylhexyl]sulfinyl-2-phenylhexyl]oxane.
| Compound Name | 2-[2-methyl-6-[5-(oxan-2-yloxy)-5-phenylhexyl]sulfinyl-2-phenylhexyl]oxane |
|---|---|
| PubChem CID | 59037073 |
| Molecular Formula | C35H52O4S |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | 2-[2-methyl-6-[5-(oxan-2-yloxy)-5-phenylhexyl]sulfinyl-2-phenylhexyl]oxane |
| SMILES | CC(CCCCS(=O)CCCCC(C)(OC1CCCCO1)c1ccccc1)(CC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C35H52O4S/c1-34(30-17-5-3-6-18-30,29-32-21-9-13-25-37-32)23-11-15-27-40(36)28-16-12-24-35(2,31-19-7-4-8-20-31)39-33-22-10-14-26-38-33/h3-8,17-20,32-33H,9-16,21-29H2,1-2H3 |
| InChIKey | JTJTZPWQCXZOLN-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|