C28H30O3S — CID 134927771
2-[(2R,3R)-2-(trityloxymethyl)thietan-3-yl]oxyoxane (PubChem CID 134927771) has the molecular formula C28H30O3S and a molecular weight of 446.61 g/mol. Its IUPAC name is 2-[(2R,3R)-2-(trityloxymethyl)thietan-3-yl]oxyoxane.
| Compound Name | 2-[(2R,3R)-2-(trityloxymethyl)thietan-3-yl]oxyoxane |
|---|---|
| PubChem CID | 134927771 |
| Molecular Formula | C28H30O3S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-[(2R,3R)-2-(trityloxymethyl)thietan-3-yl]oxyoxane |
| SMILES | c1ccc(C(OC[C@H]2SC[C@H]2OC2CCCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30O3S/c1-4-12-22(13-5-1)28(23-14-6-2-7-15-23,24-16-8-3-9-17-24)30-20-26-25(21-32-26)31-27-18-10-11-19-29-27/h1-9,12-17,25-27H,10-11,18-21H2/t25-,26-,27?/m1/s1 |
| InChIKey | LXQLXQBMEJXKLV-QMMNWOAZSA-N |
| XLogP | 6.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|