C32H36O2S4 — CID 57327238
(4S,6R)-2-phenyl-4,6-bis[(2-phenyl-1,3-dithian-2-yl)methyl]-1,3-dioxane (PubChem CID 57327238) has the molecular formula C32H36O2S4 and a molecular weight of 580.91 g/mol. Its IUPAC name is (4S,6R)-2-phenyl-4,6-bis[(2-phenyl-1,3-dithian-2-yl)methyl]-1,3-dioxane.
| Compound Name | (4S,6R)-2-phenyl-4,6-bis[(2-phenyl-1,3-dithian-2-yl)methyl]-1,3-dioxane |
|---|---|
| PubChem CID | 57327238 |
| Molecular Formula | C32H36O2S4 |
| Molecular Weight | 580.91 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | (4S,6R)-2-phenyl-4,6-bis[(2-phenyl-1,3-dithian-2-yl)methyl]-1,3-dioxane |
| SMILES | c1ccc(C2O[C@@H](CC3(c4ccccc4)SCCCS3)C[C@@H](CC3(c4ccccc4)SCCCS3)O2)cc1 |
| InChI | InChI=1S/C32H36O2S4/c1-4-12-25(13-5-1)30-33-28(23-31(35-18-10-19-36-31)26-14-6-2-7-15-26)22-29(34-30)24-32(37-20-11-21-38-32)27-16-8-3-9-17-27/h1-9,12-17,28-30H,10-11,18-24H2/t28-,29+,30? |
| InChIKey | OWDXSJVFXRRAFV-BWMKXQIXSA-N |
| XLogP | 9.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.91 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |