C24H28O6S — CID 162786754
(2R,4aR,8R,8aS)-6-(2-methylprop-2-enylsulfonyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 162786754) has the molecular formula C24H28O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is (2R,4aR,8R,8aS)-6-(2-methylprop-2-enylsulfonyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,8R,8aS)-6-(2-methylprop-2-enylsulfonyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 162786754 |
| Molecular Formula | C24H28O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2R,4aR,8R,8aS)-6-(2-methylprop-2-enylsulfonyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=C(C)CS(=O)(=O)C1C[C@@H](OCc2ccccc2)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C24H28O6S/c1-17(2)16-31(25,26)22-13-20(27-14-18-9-5-3-6-10-18)23-21(29-22)15-28-24(30-23)19-11-7-4-8-12-19/h3-12,20-24H,1,13-16H2,2H3/t20-,21-,22?,23+,24-/m1/s1 |
| InChIKey | LLIIJIBXIVICBT-BHJRHKJSSA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|