C46H56O22S2 — CID 139039201
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S)-2-methoxy-2-phenylacetyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 139039201) has the molecular formula C46H56O22S2 and a molecular weight of 1025.07 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S)-2-methoxy-2-phenylacetyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S)-2-methoxy-2-phenylacetyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139039201 |
| Molecular Formula | C46H56O22S2 |
| Molecular Weight | 1025.07 g/mol |
| Exact Mass | 1024.27 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S)-2-methoxy-2-phenylacetyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CO[C@H](C(=O)S[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)c1ccccc1.CO[C@H](C(=O)S[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/2C23H28O11S/c2*1-12(24)30-11-17-19(31-13(2)25)20(32-14(3)26)21(33-15(4)27)23(34-17)35-22(28)18(29-5)16-9-7-6-8-10-16/h2*6-10,17-21,23H,11H2,1-5H3/t2*17-,18+,19-,20+,21-,23+/m11/s1 |
| InChIKey | HVDQHFJINHTGAH-WCNMFRDXSA-N |
| XLogP | 3.43 |
| TPSA | 281.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.07 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|