C23H30O4S — CID 10549117
(4S,6S)-2,2-dimethyl-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-6-(2-phenylmethoxyethyl)-1,3-dioxane (PubChem CID 10549117) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is (4S,6S)-2,2-dimethyl-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-6-(2-phenylmethoxyethyl)-1,3-dioxane.
| Compound Name | (4S,6S)-2,2-dimethyl-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-6-(2-phenylmethoxyethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 10549117 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (4S,6S)-2,2-dimethyl-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-6-(2-phenylmethoxyethyl)-1,3-dioxane |
| SMILES | Cc1ccc([S@](=O)C[C@@H]2C[C@H](CCOCc3ccccc3)OC(C)(C)O2)cc1 |
| InChI | InChI=1S/C23H30O4S/c1-18-9-11-22(12-10-18)28(24)17-21-15-20(26-23(2,3)27-21)13-14-25-16-19-7-5-4-6-8-19/h4-12,20-21H,13-17H2,1-3H3/t20-,21-,28+/m0/s1 |
| InChIKey | BDMXJZYXOHGGME-YHGPEZAFSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|