C19H20O4S — CID 122363978
(4S,5S)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-5-phenyloxolan-3-one (PubChem CID 122363978) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-5-phenyloxolan-3-one.
| Compound Name | (4S,5S)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-5-phenyloxolan-3-one |
|---|---|
| PubChem CID | 122363978 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-5-phenyloxolan-3-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2C(=O)C(C)(C)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20O4S/c1-13-9-11-15(12-10-13)24(21,22)17-16(14-7-5-4-6-8-14)23-19(2,3)18(17)20/h4-12,16-17H,1-3H3/t16-,17-/m0/s1 |
| InChIKey | RSRITYNVAZPFPI-IRXDYDNUSA-N |
| XLogP | 3.26 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |