C24H26O6S — CID 72696815
1-[(2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone (PubChem CID 72696815) has the molecular formula C24H26O6S and a molecular weight of 442.53 g/mol. Its IUPAC name is 1-[(2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone.
| Compound Name | 1-[(2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone |
|---|---|
| PubChem CID | 72696815 |
| Molecular Formula | C24H26O6S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-[(2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone |
| SMILES | CC(=O)C1=C(C)O[C@H]2O[C@H](COCc3ccccc3)[C@H](S(=O)(=O)c3ccc(C)cc3)[C@@H]12 |
| InChI | InChI=1S/C24H26O6S/c1-15-9-11-19(12-10-15)31(26,27)23-20(14-28-13-18-7-5-4-6-8-18)30-24-22(23)21(16(2)25)17(3)29-24/h4-12,20,22-24H,13-14H2,1-3H3/t20-,22-,23+,24+/m1/s1 |
| InChIKey | BMOVAWJFAJNCRW-AZOUXBGGSA-N |
| XLogP | 3.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |