C16H19NO6S — CID 72697102
(2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide (PubChem CID 72697102) has the molecular formula C16H19NO6S and a molecular weight of 353.40 g/mol. Its IUPAC name is (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide.
| Compound Name | (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide |
|---|---|
| PubChem CID | 72697102 |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide |
| SMILES | CC1=C(C(N)=O)[C@@H]2[C@H](O1)O[C@H](CO)[C@H]2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO6S/c1-8-3-5-10(6-4-8)24(20,21)14-11(7-18)23-16-13(14)12(15(17)19)9(2)22-16/h3-6,11,13-14,16,18H,7H2,1-2H3,(H2,17,19)/t11-,13+,14-,16-/m1/s1 |
| InChIKey | CCLJKBKYHNCDNY-UZMCECQYSA-N |
| XLogP | 0.26 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |