C17H20O6S — CID 72696959
1-[(2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone (PubChem CID 72696959) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[(2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone.
| Compound Name | 1-[(2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone |
|---|---|
| PubChem CID | 72696959 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[(2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]ethanone |
| SMILES | CC(=O)C1=C(C)O[C@@H]2O[C@H](CO)[C@@H](S(=O)(=O)c3ccc(C)cc3)[C@H]12 |
| InChI | InChI=1S/C17H20O6S/c1-9-4-6-12(7-5-9)24(20,21)16-13(8-18)23-17-15(16)14(10(2)19)11(3)22-17/h4-7,13,15-18H,8H2,1-3H3/t13-,15+,16-,17-/m1/s1 |
| InChIKey | CMEXEADGMCLGJZ-XLNGHYISSA-N |
| XLogP | 1.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |