C23H34O9S — CID 11752109
ethyl (4R)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-(4-methylphenyl)sulfonylbutanoate (PubChem CID 11752109) has the molecular formula C23H34O9S and a molecular weight of 486.58 g/mol. Its IUPAC name is ethyl (4R)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-(4-methylphenyl)sulfonylbutanoate.
| Compound Name | ethyl (4R)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-(4-methylphenyl)sulfonylbutanoate |
|---|---|
| PubChem CID | 11752109 |
| Molecular Formula | C23H34O9S |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | ethyl (4R)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-(4-methylphenyl)sulfonylbutanoate |
| SMILES | CCOC(=O)C(C[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H34O9S/c1-7-28-21(25)18(33(26,27)15-10-8-14(2)9-11-15)12-16(24)19-20(32-23(5,6)31-19)17-13-29-22(3,4)30-17/h8-11,16-20,24H,7,12-13H2,1-6H3/t16-,17-,18?,19-,20-/m1/s1 |
| InChIKey | DQVORAQBBZBXIT-QMVNZYARSA-N |
| XLogP | 2.12 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |