C17H20O7S — CID 72697098
methyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate (PubChem CID 72697098) has the molecular formula C17H20O7S and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate.
| Compound Name | methyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
|---|---|
| PubChem CID | 72697098 |
| Molecular Formula | C17H20O7S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
| SMILES | COC(=O)C1=C(C)O[C@@H]2O[C@H](CO)[C@@H](S(=O)(=O)c3ccc(C)cc3)[C@H]12 |
| InChI | InChI=1S/C17H20O7S/c1-9-4-6-11(7-5-9)25(20,21)15-12(8-18)24-17-14(15)13(10(2)23-17)16(19)22-3/h4-7,12,14-15,17-18H,8H2,1-3H3/t12-,14+,15-,17-/m1/s1 |
| InChIKey | OVUOBJURZDEOEI-DUFGSWQCSA-N |
| XLogP | 0.95 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |