C18H22O5S — CID 54720162
ethyl (3aR,6S,6aR)-4-hydroxy-2,2-dimethyl-6-(phenylsulfanylmethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate (PubChem CID 54720162) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is ethyl (3aR,6S,6aR)-4-hydroxy-2,2-dimethyl-6-(phenylsulfanylmethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate.
| Compound Name | ethyl (3aR,6S,6aR)-4-hydroxy-2,2-dimethyl-6-(phenylsulfanylmethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 54720162 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | ethyl (3aR,6S,6aR)-4-hydroxy-2,2-dimethyl-6-(phenylsulfanylmethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate |
| SMILES | CCOC(=O)C1=C(O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C18H22O5S/c1-4-21-17(20)13-12(10-24-11-8-6-5-7-9-11)15-16(14(13)19)23-18(2,3)22-15/h5-9,12,15-16,19H,4,10H2,1-3H3/t12-,15+,16-/m0/s1 |
| InChIKey | FZFBDNWHXXQVFG-MAZHCROVSA-N |
| XLogP | 3.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |