C16H20O4S — CID 46834003
(3S,4S,5R)-4-hydroxy-3-[(1S)-2-hydroxy-1-phenylsulfanylethyl]-5-(2-methylprop-1-enyl)oxolan-2-one (PubChem CID 46834003) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-3-[(1S)-2-hydroxy-1-phenylsulfanylethyl]-5-(2-methylprop-1-enyl)oxolan-2-one.
| Compound Name | (3S,4S,5R)-4-hydroxy-3-[(1S)-2-hydroxy-1-phenylsulfanylethyl]-5-(2-methylprop-1-enyl)oxolan-2-one |
|---|---|
| PubChem CID | 46834003 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-3-[(1S)-2-hydroxy-1-phenylsulfanylethyl]-5-(2-methylprop-1-enyl)oxolan-2-one |
| SMILES | CC(C)=C[C@H]1OC(=O)[C@@H]([C@@H](CO)Sc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C16H20O4S/c1-10(2)8-12-15(18)14(16(19)20-12)13(9-17)21-11-6-4-3-5-7-11/h3-8,12-15,17-18H,9H2,1-2H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | AQDGJBSNMYZSTN-APIJFGDWSA-N |
| XLogP | 2.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|