C19H22O6S — CID 10022546
methyl 2-[(2R,3R,4S)-2-[(E)-4-acetyloxybut-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10022546) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S)-2-[(E)-4-acetyloxybut-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S)-2-[(E)-4-acetyloxybut-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10022546 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 2-[(2R,3R,4S)-2-[(E)-4-acetyloxybut-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1[C@H](Sc2ccccc2)C(=O)O[C@@H]1C/C=C/COC(C)=O |
| InChI | InChI=1S/C19H22O6S/c1-13(20)24-11-7-6-10-16-15(12-17(21)23-2)18(19(22)25-16)26-14-8-4-3-5-9-14/h3-9,15-16,18H,10-12H2,1-2H3/b7-6+/t15-,16-,18+/m1/s1 |
| InChIKey | IIRWUXJMSQSUGL-FYFHTKEFSA-N |
| XLogP | 2.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|