C13H14O4S — CID 10244655
methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10244655) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10244655 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1COC(=O)[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C13H14O4S/c1-16-11(14)7-9-8-17-13(15)12(9)18-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3/t9-,12+/m1/s1 |
| InChIKey | BYQAIBFKIUGOSP-SKDRFNHKSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |