methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate

C13H14O4S — CID 10244655

IUPACmethyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate
SMILESCOC(=O)C[C@@H]1COC(=O)[C@H]1Sc1ccccc1
InChIInChI=1S/C13H14O4S/c1-16-11(14)7-9-8-17-13(15)12(9)18-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3/t9-,12+/m1/s1
InChIKeyBYQAIBFKIUGOSP-SKDRFNHKSA-N
MW266.32 g/mol
LogP1.88
Rot. Bonds4

About methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate

methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10244655) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate
PubChem CID10244655
Molecular FormulaC13H14O4S
Molecular Weight266.32 g/mol
Exact Mass266.06
IUPAC Namemethyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate
SMILESCOC(=O)C[C@@H]1COC(=O)[C@H]1Sc1ccccc1
InChIInChI=1S/C13H14O4S/c1-16-11(14)7-9-8-17-13(15)12(9)18-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3/t9-,12+/m1/s1
InChIKeyBYQAIBFKIUGOSP-SKDRFNHKSA-N
XLogP1.88
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.32
LogP ≤ 51.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate?
The IUPAC name of methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (CID 10244655) is methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate?
The canonical SMILES for methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate is COC(=O)C[C@@H]1COC(=O)[C@H]1Sc1ccccc1.
What is the InChIKey of methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate?
The InChIKey is BYQAIBFKIUGOSP-SKDRFNHKSA-N. The full InChI is InChI=1S/C13H14O4S/c1-16-11(14)7-9-8-17-13(15)12(9)18-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3/t9-,12+/m1/s1.
What are the key properties of methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate?
methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate has a molecular weight of 266.32 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3R,4S)-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate is sourced from PubChem (CID 10244655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).