C14H18O7S2 — CID 10384035
2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-5-oxooxolan-3-yl]ethyl methanesulfonate (PubChem CID 10384035) has the molecular formula C14H18O7S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-5-oxooxolan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-5-oxooxolan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 10384035 |
| Molecular Formula | C14H18O7S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-5-oxooxolan-3-yl]ethyl methanesulfonate |
| SMILES | C[C@H]1OC(=O)[C@@H](S(=O)(=O)c2ccccc2)[C@@H]1CCOS(C)(=O)=O |
| InChI | InChI=1S/C14H18O7S2/c1-10-12(8-9-20-22(2,16)17)13(14(15)21-10)23(18,19)11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3/t10-,12-,13+/m1/s1 |
| InChIKey | ZYKPTYLFHOBPEW-RTXFEEFZSA-N |
| XLogP | 0.76 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|