C22H28O6S — CID 10319968
methyl 2-[(2R,3R,4S)-2-[(E)-4-(oxan-2-yloxy)but-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10319968) has the molecular formula C22H28O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S)-2-[(E)-4-(oxan-2-yloxy)but-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S)-2-[(E)-4-(oxan-2-yloxy)but-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10319968 |
| Molecular Formula | C22H28O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | methyl 2-[(2R,3R,4S)-2-[(E)-4-(oxan-2-yloxy)but-2-enyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1[C@H](Sc2ccccc2)C(=O)O[C@@H]1C/C=C/COC1CCCCO1 |
| InChI | InChI=1S/C22H28O6S/c1-25-19(23)15-17-18(11-5-7-13-26-20-12-6-8-14-27-20)28-22(24)21(17)29-16-9-3-2-4-10-16/h2-5,7,9-10,17-18,20-21H,6,8,11-15H2,1H3/b7-5+/t17-,18-,20?,21+/m1/s1 |
| InChIKey | GYQMCYWIQWQURB-YRNNDXNLSA-N |
| XLogP | 3.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|